C12H10F15NO4S — CID 165362539
2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoylamino)ethanesulfonic acid (PubChem CID 165362539) has the molecular formula C12H10F15NO4S and a molecular weight of 549.25 g/mol. Its IUPAC name is 2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoylamino)ethanesulfonic acid.
| Compound Name | 2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoylamino)ethanesulfonic acid |
|---|---|
| PubChem CID | 165362539 |
| Molecular Formula | C12H10F15NO4S |
| Molecular Weight | 549.25 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | 2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoylamino)ethanesulfonic acid |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NCCS(=O)(=O)O |
| InChI | InChI=1S/C12H10F15NO4S/c13-6(14,2-1-5(29)28-3-4-33(30,31)32)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h1-4H2,(H,28,29)(H,30,31,32) |
| InChIKey | OYMHNAGKAKNMTM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|