C8H2F12O3 — CID 165362579
2,2,3,3-tetrafluoro-3-[3-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)oxiran-2-yl]propanoic acid (PubChem CID 165362579) has the molecular formula C8H2F12O3 and a molecular weight of 374.08 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-[3-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)oxiran-2-yl]propanoic acid.
| Compound Name | 2,2,3,3-tetrafluoro-3-[3-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)oxiran-2-yl]propanoic acid |
|---|---|
| PubChem CID | 165362579 |
| Molecular Formula | C8H2F12O3 |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-[3-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)oxiran-2-yl]propanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C1OC1(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F12O3/c9-3(10,4(11,12)2(21)22)1-5(13,23-1)6(14,15)7(16,17)8(18,19)20/h1H,(H,21,22) |
| InChIKey | XVEOCSRISIXYLI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|