sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione

C5H7N2NaO2 — CID 165362697

IUPACsodium 5,5-dimethylimidazolidin-1-ide-2,4-dione
SMILESCC1(C)[N-]C(=O)NC1=O.[Na+]
InChIInChI=1S/C5H8N2O2.Na/c1-5(2)3(8)6-4(9)7-5;/h1-2H3,(H2,6,7,8,9);/q;+1/p-1
InChIKeyDVEXCFGLSZMLNN-UHFFFAOYSA-M
MW150.11 g/mol
LogP-2.61
Rot. Bonds

About sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione

sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione (PubChem CID 165362697) has the molecular formula C5H7N2NaO2 and a molecular weight of 150.11 g/mol. Its IUPAC name is sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione.

Molecular Properties

Compound Namesodium 5,5-dimethylimidazolidin-1-ide-2,4-dione
PubChem CID165362697
Molecular FormulaC5H7N2NaO2
Molecular Weight150.11 g/mol
Exact Mass150.04
IUPAC Namesodium 5,5-dimethylimidazolidin-1-ide-2,4-dione
SMILESCC1(C)[N-]C(=O)NC1=O.[Na+]
InChIInChI=1S/C5H8N2O2.Na/c1-5(2)3(8)6-4(9)7-5;/h1-2H3,(H2,6,7,8,9);/q;+1/p-1
InChIKeyDVEXCFGLSZMLNN-UHFFFAOYSA-M
XLogP-2.61
TPSA60.27 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.11
LogP ≤ 5-2.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydantoin', 'substructure': 'N/A'}

Analyze sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione?
The IUPAC name of sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione (CID 165362697) is sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione.
What is the SMILES notation for sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione?
The canonical SMILES for sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione is CC1(C)[N-]C(=O)NC1=O.[Na+].
What is the InChIKey of sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione?
The InChIKey is DVEXCFGLSZMLNN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8N2O2.Na/c1-5(2)3(8)6-4(9)7-5;/h1-2H3,(H2,6,7,8,9);/q;+1/p-1.
What are the key properties of sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione?
sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione has a molecular weight of 150.11 g/mol, XLogP of -2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5,5-dimethylimidazolidin-1-ide-2,4-dione is sourced from PubChem (CID 165362697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).