C36H70N2O4 — CID 165362812
10-methylundecyl N-[[1,3,3-trimethyl-5-(10-methylundecoxycarbonylamino)cyclohexyl]methyl]carbamate (PubChem CID 165362812) has the molecular formula C36H70N2O4 and a molecular weight of 594.97 g/mol. Its IUPAC name is 10-methylundecyl N-[[1,3,3-trimethyl-5-(10-methylundecoxycarbonylamino)cyclohexyl]methyl]carbamate.
| Compound Name | 10-methylundecyl N-[[1,3,3-trimethyl-5-(10-methylundecoxycarbonylamino)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 165362812 |
| Molecular Formula | C36H70N2O4 |
| Molecular Weight | 594.97 g/mol |
| Exact Mass | 594.53 |
| IUPAC Name | 10-methylundecyl N-[[1,3,3-trimethyl-5-(10-methylundecoxycarbonylamino)cyclohexyl]methyl]carbamate |
| SMILES | CC(C)CCCCCCCCCOC(=O)NCC1(C)CC(NC(=O)OCCCCCCCCCC(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C36H70N2O4/c1-30(2)22-18-14-10-8-12-16-20-24-41-33(39)37-29-36(7)27-32(26-35(5,6)28-36)38-34(40)42-25-21-17-13-9-11-15-19-23-31(3)4/h30-32H,8-29H2,1-7H3,(H,37,39)(H,38,40) |
| InChIKey | DXKNETNKUHINMM-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.97 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|