C23H23NO6 — CID 165363150
(Z)-3-[3-[2-amino-2-oxo-1-(3-phenoxyphenyl)ethoxy]carbonyl-2,2-dimethylcyclopropyl]prop-2-enoic acid (PubChem CID 165363150) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is (Z)-3-[3-[2-amino-2-oxo-1-(3-phenoxyphenyl)ethoxy]carbonyl-2,2-dimethylcyclopropyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[3-[2-amino-2-oxo-1-(3-phenoxyphenyl)ethoxy]carbonyl-2,2-dimethylcyclopropyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 165363150 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (Z)-3-[3-[2-amino-2-oxo-1-(3-phenoxyphenyl)ethoxy]carbonyl-2,2-dimethylcyclopropyl]prop-2-enoic acid |
| SMILES | CC1(C)C(/C=C\C(=O)O)C1C(=O)OC(C(N)=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H23NO6/c1-23(2)17(11-12-18(25)26)19(23)22(28)30-20(21(24)27)14-7-6-10-16(13-14)29-15-8-4-3-5-9-15/h3-13,17,19-20H,1-2H3,(H2,24,27)(H,25,26)/b12-11- |
| InChIKey | OGXOFXISOFSZPL-QXMHVHEDSA-N |
| XLogP | 3.46 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|