About 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride
2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride (PubChem CID 165363226) has the molecular formula C16H23ClN4O2S
and a molecular weight of 370.91 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride |
| PubChem CID | 165363226 |
| Molecular Formula | C16H23ClN4O2S |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride |
| SMILES | CCN(CC)CCSC(=NO)c1nc(Cc2ccccc2)no1.Cl |
| InChI | InChI=1S/C16H22N4O2S.ClH/c1-3-20(4-2)10-11-23-16(18-21)15-17-14(19-22-15)12-13-8-6-5-7-9-13;/h5-9,21H,3-4,10-12H2,1-2H3;1H |
| InChIKey | DOQWAVZRPZOKJJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride (CID 165363226) is 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride is CCN(CC)CCSC(=NO)c1nc(Cc2ccccc2)no1.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride?
The InChIKey is DOQWAVZRPZOKJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O2S.ClH/c1-3-20(4-2)10-11-23-16(18-21)15-17-14(19-22-15)12-13-8-6-5-7-9-13;/h5-9,21H,3-4,10-12H2,1-2H3;1H.
What are the key properties of 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride?
2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride has a molecular weight of 370.91 g/mol, XLogP of 3.29, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 3-benzyl-N-hydroxy-1,2,4-oxadiazole-5-carboximidothioate;hydrochloride is sourced from PubChem (CID 165363226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).