C20H23N3O10S — CID 165363331
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-methyl-4-[(2-methyl-4-sulfooxyphenyl)diazenyl]anilino]oxane-2-carboxylic acid (PubChem CID 165363331) has the molecular formula C20H23N3O10S and a molecular weight of 497.48 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-methyl-4-[(2-methyl-4-sulfooxyphenyl)diazenyl]anilino]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-methyl-4-[(2-methyl-4-sulfooxyphenyl)diazenyl]anilino]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 165363331 |
| Molecular Formula | C20H23N3O10S |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-methyl-4-[(2-methyl-4-sulfooxyphenyl)diazenyl]anilino]oxane-2-carboxylic acid |
| SMILES | Cc1cc(OS(=O)(=O)O)ccc1/N=N/c1ccc(N[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c(C)c1 |
| InChI | InChI=1S/C20H23N3O10S/c1-9-7-11(22-23-14-6-4-12(8-10(14)2)33-34(29,30)31)3-5-13(9)21-19-17(26)15(24)16(25)18(32-19)20(27)28/h3-8,15-19,21,24-26H,1-2H3,(H,27,28)(H,29,30,31)/b23-22+/t15-,16-,17+,18-,19+/m0/s1 |
| InChIKey | KSPYKKJJZIESCX-KVCIKILCSA-N |
| XLogP | 1.20 |
| TPSA | 207.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|