C20H31NO4 — CID 165363422
5'-(N-ethoxy-C-propylcarbonimidoyl)-4'-hydroxyspiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-pyran]-6'-one (PubChem CID 165363422) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 5'-(N-ethoxy-C-propylcarbonimidoyl)-4'-hydroxyspiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-pyran]-6'-one.
| Compound Name | 5'-(N-ethoxy-C-propylcarbonimidoyl)-4'-hydroxyspiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-pyran]-6'-one |
|---|---|
| PubChem CID | 165363422 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 5'-(N-ethoxy-C-propylcarbonimidoyl)-4'-hydroxyspiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-pyran]-6'-one |
| SMILES | CCCC(=NOCC)C1=C(O)CC2(CCCC3CCCCC32)OC1=O |
| InChI | InChI=1S/C20H31NO4/c1-3-8-16(21-24-4-2)18-17(22)13-20(25-19(18)23)12-7-10-14-9-5-6-11-15(14)20/h14-15,22H,3-13H2,1-2H3 |
| InChIKey | SRUBVBHAENAFIV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|