C12H22N4O5S — CID 165363541
[(2S,5R)-2-(piperidin-4-ylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 165363541) has the molecular formula C12H22N4O5S and a molecular weight of 334.40 g/mol. Its IUPAC name is [(2S,5R)-2-(piperidin-4-ylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-(piperidin-4-ylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 165363541 |
| Molecular Formula | C12H22N4O5S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [(2S,5R)-2-(piperidin-4-ylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NC1CCNCC1)[C@@H]1CC[C@@H]2CN1CN2OS(=O)(=O)O |
| InChI | InChI=1S/C12H22N4O5S/c17-12(14-9-3-5-13-6-4-9)11-2-1-10-7-15(11)8-16(10)21-22(18,19)20/h9-11,13H,1-8H2,(H,14,17)(H,18,19,20)/t10-,11+/m1/s1 |
| InChIKey | XDIOKWVUBKVWJE-MNOVXSKESA-N |
| XLogP | -1.30 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|