C20H25NO5 — CID 165363624
4-[4-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3,5-dioxocyclohexyl]-3,5-dimethylbenzoic acid (PubChem CID 165363624) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 4-[4-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3,5-dioxocyclohexyl]-3,5-dimethylbenzoic acid.
| Compound Name | 4-[4-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3,5-dioxocyclohexyl]-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 165363624 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-[4-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3,5-dioxocyclohexyl]-3,5-dimethylbenzoic acid |
| SMILES | CCO/N=C(\CC)C1C(=O)CC(c2c(C)cc(C(=O)O)cc2C)CC1=O |
| InChI | InChI=1S/C20H25NO5/c1-5-15(21-26-6-2)19-16(22)9-13(10-17(19)23)18-11(3)7-14(20(24)25)8-12(18)4/h7-8,13,19H,5-6,9-10H2,1-4H3,(H,24,25)/b21-15+ |
| InChIKey | OTBNNBHRFRMUHN-RCCKNPSSSA-N |
| XLogP | 3.44 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|