C17H30O2 — CID 165363673
5-butan-2-yl-2-[(1S,2S)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane (PubChem CID 165363673) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 5-butan-2-yl-2-[(1S,2S)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane.
| Compound Name | 5-butan-2-yl-2-[(1S,2S)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 165363673 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 5-butan-2-yl-2-[(1S,2S)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane |
| SMILES | CCC(C)C1(C)COC([C@H]2CCC(C)=C[C@@H]2C)OC1 |
| InChI | InChI=1S/C17H30O2/c1-6-14(4)17(5)10-18-16(19-11-17)15-8-7-12(2)9-13(15)3/h9,13-16H,6-8,10-11H2,1-5H3/t13-,14?,15-,16?,17?/m0/s1 |
| InChIKey | DASQRZJTRKBKPP-QWFZCGKBSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|