C19H19FN6O5S2 — CID 165363742
2-amino-4-[[4-[N-(2-ethenylsulfonylethyl)anilino]-6-fluoro-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 165363742) has the molecular formula C19H19FN6O5S2 and a molecular weight of 494.53 g/mol. Its IUPAC name is 2-amino-4-[[4-[N-(2-ethenylsulfonylethyl)anilino]-6-fluoro-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-amino-4-[[4-[N-(2-ethenylsulfonylethyl)anilino]-6-fluoro-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 165363742 |
| Molecular Formula | C19H19FN6O5S2 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 2-amino-4-[[4-[N-(2-ethenylsulfonylethyl)anilino]-6-fluoro-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CCN(c1ccccc1)c1nc(F)nc(Nc2ccc(S(=O)(=O)O)c(N)c2)n1 |
| InChI | InChI=1S/C19H19FN6O5S2/c1-2-32(27,28)11-10-26(14-6-4-3-5-7-14)19-24-17(20)23-18(25-19)22-13-8-9-16(15(21)12-13)33(29,30)31/h2-9,12H,1,10-11,21H2,(H,29,30,31)(H,22,23,24,25) |
| InChIKey | BDKKBAREKNHYTR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 168.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|