About (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane
(2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane (PubChem CID 165363851) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane.
Molecular Properties
| Compound Name | (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane |
| PubChem CID | 165363851 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane |
| SMILES | COc1cc(OC)c(C2O[C@@H]2C)cc1OC |
| InChI | InChI=1S/C12H16O4/c1-7-12(16-7)8-5-10(14-3)11(15-4)6-9(8)13-2/h5-7,12H,1-4H3/t7-,12?/m1/s1 |
| InChIKey | NPWQZYRDLOGPMX-OJYJAAIMSA-N |
| XLogP | 2.17 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane?
The IUPAC name of (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane (CID 165363851) is (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane.
What is the SMILES notation for (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane?
The canonical SMILES for (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane is COc1cc(OC)c(C2O[C@@H]2C)cc1OC.
What is the InChIKey of (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane?
The InChIKey is NPWQZYRDLOGPMX-OJYJAAIMSA-N. The full InChI is InChI=1S/C12H16O4/c1-7-12(16-7)8-5-10(14-3)11(15-4)6-9(8)13-2/h5-7,12H,1-4H3/t7-,12?/m1/s1.
What are the key properties of (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane?
(2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane has a molecular weight of 224.26 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-3-(2,4,5-trimethoxyphenyl)oxirane is sourced from PubChem (CID 165363851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).