C15H22O2S — CID 165363852
3-[(1E,3E,5E,7E,9E)-dodeca-1,3,5,7,9-pentaenyl]sulfanylpropane-1,2-diol (PubChem CID 165363852) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 3-[(1E,3E,5E,7E,9E)-dodeca-1,3,5,7,9-pentaenyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[(1E,3E,5E,7E,9E)-dodeca-1,3,5,7,9-pentaenyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 165363852 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-[(1E,3E,5E,7E,9E)-dodeca-1,3,5,7,9-pentaenyl]sulfanylpropane-1,2-diol |
| SMILES | CC/C=C/C=C/C=C/C=C/C=C/SCC(O)CO |
| InChI | InChI=1S/C15H22O2S/c1-2-3-4-5-6-7-8-9-10-11-12-18-14-15(17)13-16/h3-12,15-17H,2,13-14H2,1H3/b4-3+,6-5+,8-7+,10-9+,12-11+ |
| InChIKey | FOYVCDUDSKGPSD-STAPSFGWSA-N |
| XLogP | 3.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|