C23H22 — CID 165364054
(9R,10S)-3,9,10-trimethyl-1,2,9,10-tetrahydrobenzo[j]aceanthrylene (PubChem CID 165364054) has the molecular formula C23H22 and a molecular weight of 298.43 g/mol. Its IUPAC name is (9R,10S)-3,9,10-trimethyl-1,2,9,10-tetrahydrobenzo[j]aceanthrylene.
| Compound Name | (9R,10S)-3,9,10-trimethyl-1,2,9,10-tetrahydrobenzo[j]aceanthrylene |
|---|---|
| PubChem CID | 165364054 |
| Molecular Formula | C23H22 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (9R,10S)-3,9,10-trimethyl-1,2,9,10-tetrahydrobenzo[j]aceanthrylene |
| SMILES | Cc1ccc2cc3c4c(ccc3c3c2c1CC3)[C@@H](C)[C@H](C)C=C4 |
| InChI | InChI=1S/C23H22/c1-13-5-7-19-18(15(13)3)9-10-20-21-11-8-17-14(2)4-6-16(23(17)21)12-22(19)20/h4-7,9-10,12-13,15H,8,11H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | OHSIYFUKLRFUEW-HIFRSBDPSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|