C10H19F5N2O5S2 — CID 165364575
3-[dimethyl-[3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl]azaniumyl]propane-1-sulfonate (PubChem CID 165364575) has the molecular formula C10H19F5N2O5S2 and a molecular weight of 406.40 g/mol. Its IUPAC name is 3-[dimethyl-[3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 3-[dimethyl-[3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 165364575 |
| Molecular Formula | C10H19F5N2O5S2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3-[dimethyl-[3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl]azaniumyl]propane-1-sulfonate |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)F)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H19F5N2O5S2/c1-17(2,7-4-8-23(18,19)20)6-3-5-16-24(21,22)10(14,15)9(11,12)13/h16H,3-8H2,1-2H3 |
| InChIKey | GDVFZOZBFJNYEM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|