C24H9K2NO6 — CID 165364788
dipotassium;15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2(23),3,5,7,9,11,13,18(22),19-decaene-5,7-dicarboxylate (PubChem CID 165364788) has the molecular formula C24H9K2NO6 and a molecular weight of 485.53 g/mol. Its IUPAC name is dipotassium;15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2(23),3,5,7,9,11,13,18(22),19-decaene-5,7-dicarboxylate.
| Compound Name | dipotassium;15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2(23),3,5,7,9,11,13,18(22),19-decaene-5,7-dicarboxylate |
|---|---|
| PubChem CID | 165364788 |
| Molecular Formula | C24H9K2NO6 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 484.97 |
| IUPAC Name | dipotassium;15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2(23),3,5,7,9,11,13,18(22),19-decaene-5,7-dicarboxylate |
| SMILES | O=C([O-])c1ccc2c3ccc4c5c(ccc(c6ccc(C(=O)[O-])c1c26)c53)C(=O)NC4=O.[K+].[K+] |
| InChI | InChI=1S/C24H11NO6.2K/c26-21-13-5-1-9-11-3-7-15(23(28)29)20-16(24(30)31)8-4-12(18(11)20)10-2-6-14(22(27)25-21)19(13)17(9)10;;/h1-8H,(H,28,29)(H,30,31)(H,25,26,27);;/q;2*+1/p-2 |
| InChIKey | UVMSATIIOLAVOK-UHFFFAOYSA-L |
| XLogP | -4.64 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|