C15H24O5S — CID 165364821
ethyl (3aR,7R,7aR)-2,2-dimethyl-7-[methyl(dimethylidene)-λ6-sulfanyl]oxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 165364821) has the molecular formula C15H24O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is ethyl (3aR,7R,7aR)-2,2-dimethyl-7-[methyl(dimethylidene)-λ6-sulfanyl]oxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | ethyl (3aR,7R,7aR)-2,2-dimethyl-7-[methyl(dimethylidene)-λ6-sulfanyl]oxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 165364821 |
| Molecular Formula | C15H24O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | ethyl (3aR,7R,7aR)-2,2-dimethyl-7-[methyl(dimethylidene)-λ6-sulfanyl]oxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | C=S(=C)(C)O[C@@H]1CC(C(=O)OCC)=C[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H24O5S/c1-7-17-14(16)10-8-11-13(19-15(2,3)18-11)12(9-10)20-21(4,5)6/h8,11-13H,4-5,7,9H2,1-3,6H3/t11-,12-,13-/m1/s1 |
| InChIKey | PRRFQXHAXJDWGV-JHJVBQTASA-N |
| XLogP | 2.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|