C23H40O5 — CID 165365141
(E,2R,4R)-2-[(2R,3S,4S,5R,6R)-2,4-dihydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]-4,6-dimethylnon-6-en-3-one (PubChem CID 165365141) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is (E,2R,4R)-2-[(2R,3S,4S,5R,6R)-2,4-dihydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]-4,6-dimethylnon-6-en-3-one.
| Compound Name | (E,2R,4R)-2-[(2R,3S,4S,5R,6R)-2,4-dihydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]-4,6-dimethylnon-6-en-3-one |
|---|---|
| PubChem CID | 165365141 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | (E,2R,4R)-2-[(2R,3S,4S,5R,6R)-2,4-dihydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]-4,6-dimethylnon-6-en-3-one |
| SMILES | CC/C=C(\C)C[C@@H](C)C(=O)[C@@H](C)[C@]1(O)O[C@@H]([C@H](C)C(=O)CC)[C@H](C)[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C23H40O5/c1-9-11-13(3)12-14(4)20(25)17(7)23(27)18(8)21(26)16(6)22(28-23)15(5)19(24)10-2/h11,14-18,21-22,26-27H,9-10,12H2,1-8H3/b13-11+/t14-,15-,16-,17-,18+,21+,22+,23+/m1/s1 |
| InChIKey | BFQWBQIYMSVPOL-PVHLRTRVSA-N |
| XLogP | 3.91 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|