About N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide
N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide (PubChem CID 165365257) has the molecular formula C22H26N4O2
and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide |
| PubChem CID | 165365257 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1nn(CCc2ccccc2)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C22H26N4O2/c1-22(2,3)19(20(23)27)24-21(28)18-16-11-7-8-12-17(16)26(25-18)14-13-15-9-5-4-6-10-15/h4-12,19H,13-14H2,1-3H3,(H2,23,27)(H,24,28)/t19-/m1/s1 |
| InChIKey | GIUNLIQZFMBOGJ-LJQANCHMSA-N |
| XLogP | 2.91 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide?
The IUPAC name of N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide (CID 165365257) is N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide.
What is the SMILES notation for N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide?
The canonical SMILES for N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide is CC(C)(C)[C@H](NC(=O)c1nn(CCc2ccccc2)c2ccccc12)C(N)=O.
What is the InChIKey of N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide?
The InChIKey is GIUNLIQZFMBOGJ-LJQANCHMSA-N. The full InChI is InChI=1S/C22H26N4O2/c1-22(2,3)19(20(23)27)24-21(28)18-16-11-7-8-12-17(16)26(25-18)14-13-15-9-5-4-6-10-15/h4-12,19H,13-14H2,1-3H3,(H2,23,27)(H,24,28)/t19-/m1/s1.
What are the key properties of N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide?
N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide has a molecular weight of 378.48 g/mol, XLogP of 2.91, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(2-phenylethyl)indazole-3-carboxamide is sourced from PubChem (CID 165365257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).