C21H20N2O7S — CID 16536546
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone (PubChem CID 16536546) has the molecular formula C21H20N2O7S and a molecular weight of 444.47 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 16536546 |
| Molecular Formula | C21H20N2O7S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
| SMILES | COc1cc(-c2nnc(SCC(=O)c3ccc4c(c3)OCCO4)o2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20N2O7S/c1-25-17-9-13(10-18(26-2)19(17)27-3)20-22-23-21(30-20)31-11-14(24)12-4-5-15-16(8-12)29-7-6-28-15/h4-5,8-10H,6-7,11H2,1-3H3 |
| InChIKey | DNICDOJEGVUZTR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 102.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |