About 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione
2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione (PubChem CID 165365722) has the molecular formula C6H9N5S
and a molecular weight of 183.24 g/mol. Its IUPAC name is 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione.
Molecular Properties
| Compound Name | 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione |
| PubChem CID | 165365722 |
| Molecular Formula | C6H9N5S |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione |
| SMILES | CN1C(=S)c2[nH]cnc2NC1N |
| InChI | InChI=1S/C6H9N5S/c1-11-5(12)3-4(9-2-8-3)10-6(11)7/h2,6,10H,7H2,1H3,(H,8,9) |
| InChIKey | AGCBAXQGWNTZMA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione?
The IUPAC name of 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione (CID 165365722) is 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione.
What is the SMILES notation for 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione?
The canonical SMILES for 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione is CN1C(=S)c2[nH]cnc2NC1N.
What is the InChIKey of 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione?
The InChIKey is AGCBAXQGWNTZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5S/c1-11-5(12)3-4(9-2-8-3)10-6(11)7/h2,6,10H,7H2,1H3,(H,8,9).
What are the key properties of 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione?
2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione has a molecular weight of 183.24 g/mol, XLogP of -0.32, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-methyl-3,7-dihydro-2H-purine-6-thione is sourced from PubChem (CID 165365722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).