C22H17F6NO4S3 — CID 165365817
4,4,5,5,6,6-hexafluoro-1λ6,3λ6-dithia-2-azanidacyclohexane 1,1,3,3-tetraoxide;(4-methylphenyl)-diphenylsulfanium (PubChem CID 165365817) has the molecular formula C22H17F6NO4S3 and a molecular weight of 569.57 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexafluoro-1λ6,3λ6-dithia-2-azanidacyclohexane 1,1,3,3-tetraoxide;(4-methylphenyl)-diphenylsulfanium.
| Compound Name | 4,4,5,5,6,6-hexafluoro-1λ6,3λ6-dithia-2-azanidacyclohexane 1,1,3,3-tetraoxide;(4-methylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 165365817 |
| Molecular Formula | C22H17F6NO4S3 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.02 |
| IUPAC Name | 4,4,5,5,6,6-hexafluoro-1λ6,3λ6-dithia-2-azanidacyclohexane 1,1,3,3-tetraoxide;(4-methylphenyl)-diphenylsulfanium |
| SMILES | Cc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S1(=O)[N-]S(=O)(=O)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C19H17S.C3F6NO4S2/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;4-1(5)2(6,7)15(11,12)10-16(13,14)3(1,8)9/h2-15H,1H3;/q+1;-1 |
| InChIKey | NYGAFOUHFFCDBS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|