C58H123N9O21Si5 — CID 165366024
3-[6-[3,5-bis[6-[bis(3-trimethoxysilylpropyl)carbamoylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl]-1-butyl-1-(3-trimethoxysilylpropyl)urea (PubChem CID 165366024) has the molecular formula C58H123N9O21Si5 and a molecular weight of 1423.09 g/mol. Its IUPAC name is 3-[6-[3,5-bis[6-[bis(3-trimethoxysilylpropyl)carbamoylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl]-1-butyl-1-(3-trimethoxysilylpropyl)urea.
| Compound Name | 3-[6-[3,5-bis[6-[bis(3-trimethoxysilylpropyl)carbamoylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl]-1-butyl-1-(3-trimethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 165366024 |
| Molecular Formula | C58H123N9O21Si5 |
| Molecular Weight | 1423.09 g/mol |
| Exact Mass | 1421.77 |
| IUPAC Name | 3-[6-[3,5-bis[6-[bis(3-trimethoxysilylpropyl)carbamoylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl]-1-butyl-1-(3-trimethoxysilylpropyl)urea |
| SMILES | CCCCN(CCC[Si](OC)(OC)OC)C(=O)NCCCCCCn1c(=O)n(CCCCCCNC(=O)N(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)c(=O)n(CCCCCCNC(=O)N(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)c1=O |
| InChI | InChI=1S/C58H123N9O21Si5/c1-17-18-39-62(40-31-48-89(74-2,75-3)76-4)53(68)59-36-25-19-22-28-45-65-56(71)66(46-29-23-20-26-37-60-54(69)63(41-32-49-90(77-5,78-6)79-7)42-33-50-91(80-8,81-9)82-10)58(73)67(57(65)72)47-30-24-21-27-38-61-55(70)64(43-34-51-92(83-11,84-12)85-13)44-35-52-93(86-14,87-15)88-16/h17-52H2,1-16H3,(H,59,68)(H,60,69)(H,61,70) |
| InChIKey | OCRJMKKKYKFHGU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 301.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 59 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1423.09 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|