C33H44O4S2Si — CID 165366570
(2R,3S,5R)-1-[tert-butyl(diphenyl)silyl]oxy-5-(1,3-dithiolan-2-yl)-5-methoxy-2-methyl-3-phenylmethoxypentan-2-ol (PubChem CID 165366570) has the molecular formula C33H44O4S2Si and a molecular weight of 596.93 g/mol. Its IUPAC name is (2R,3S,5R)-1-[tert-butyl(diphenyl)silyl]oxy-5-(1,3-dithiolan-2-yl)-5-methoxy-2-methyl-3-phenylmethoxypentan-2-ol.
| Compound Name | (2R,3S,5R)-1-[tert-butyl(diphenyl)silyl]oxy-5-(1,3-dithiolan-2-yl)-5-methoxy-2-methyl-3-phenylmethoxypentan-2-ol |
|---|---|
| PubChem CID | 165366570 |
| Molecular Formula | C33H44O4S2Si |
| Molecular Weight | 596.93 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | (2R,3S,5R)-1-[tert-butyl(diphenyl)silyl]oxy-5-(1,3-dithiolan-2-yl)-5-methoxy-2-methyl-3-phenylmethoxypentan-2-ol |
| SMILES | CO[C@H](C[C@H](OCc1ccccc1)[C@](C)(O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1SCCS1 |
| InChI | InChI=1S/C33H44O4S2Si/c1-32(2,3)40(27-17-11-7-12-18-27,28-19-13-8-14-20-28)37-25-33(4,34)30(36-24-26-15-9-6-10-16-26)23-29(35-5)31-38-21-22-39-31/h6-20,29-31,34H,21-25H2,1-5H3/t29-,30+,33-/m1/s1 |
| InChIKey | OYORTNUWHRKEKY-YLJHYDRVSA-N |
| XLogP | 6.11 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.93 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|