C37H43N3O9 — CID 165366747
methyl (1S,3R,4R,5S)-3-acetyloxy-5-azido-4-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexane-1-carboxylate (PubChem CID 165366747) has the molecular formula C37H43N3O9 and a molecular weight of 673.76 g/mol. Its IUPAC name is methyl (1S,3R,4R,5S)-3-acetyloxy-5-azido-4-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3R,4R,5S)-3-acetyloxy-5-azido-4-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 165366747 |
| Molecular Formula | C37H43N3O9 |
| Molecular Weight | 673.76 g/mol |
| Exact Mass | 673.30 |
| IUPAC Name | methyl (1S,3R,4R,5S)-3-acetyloxy-5-azido-4-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](N=[N+]=[N-])[C@@H](O[C@@H]2O[C@@H](C)[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C37H43N3O9/c1-24-32(44-21-26-13-7-4-8-14-26)34(45-22-27-15-9-5-10-16-27)35(46-23-28-17-11-6-12-18-28)37(47-24)49-33-30(39-40-38)19-29(36(42)43-3)20-31(33)48-25(2)41/h4-18,24,29-35,37H,19-23H2,1-3H3/t24-,29-,30-,31+,32+,33+,34+,35-,37-/m0/s1 |
| InChIKey | LYDXTZPBNAFLCJ-UUGACNKSSA-N |
| XLogP | 6.07 |
| TPSA | 147.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.76 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|