C22H40O2Si — CID 165366991
(3aR,7aR)-3a,7a-dimethyl-1-[(2R)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-3,5,6,7-tetrahydroinden-4-one (PubChem CID 165366991) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (3aR,7aR)-3a,7a-dimethyl-1-[(2R)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-3,5,6,7-tetrahydroinden-4-one.
| Compound Name | (3aR,7aR)-3a,7a-dimethyl-1-[(2R)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-3,5,6,7-tetrahydroinden-4-one |
|---|---|
| PubChem CID | 165366991 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (3aR,7aR)-3a,7a-dimethyl-1-[(2R)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-3,5,6,7-tetrahydroinden-4-one |
| SMILES | C[C@H](CCCC(C)(C)O[Si](C)(C)C)C1=CC[C@@]2(C)C(=O)CCC[C@]12C |
| InChI | InChI=1S/C22H40O2Si/c1-17(11-9-14-20(2,3)24-25(6,7)8)18-13-16-22(5)19(23)12-10-15-21(18,22)4/h13,17H,9-12,14-16H2,1-8H3/t17-,21-,22+/m1/s1 |
| InChIKey | IXURTUTZQAQTKG-YHYVQYDKSA-N |
| XLogP | 6.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|