C20H32O2 — CID 165367123
(1S,2R,5R,7S,10R,11R)-2,11-dimethyl-5-propan-2-yl-15-oxatetracyclo[9.3.2.01,10.02,7]hexadecan-16-one (PubChem CID 165367123) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,2R,5R,7S,10R,11R)-2,11-dimethyl-5-propan-2-yl-15-oxatetracyclo[9.3.2.01,10.02,7]hexadecan-16-one.
| Compound Name | (1S,2R,5R,7S,10R,11R)-2,11-dimethyl-5-propan-2-yl-15-oxatetracyclo[9.3.2.01,10.02,7]hexadecan-16-one |
|---|---|
| PubChem CID | 165367123 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,2R,5R,7S,10R,11R)-2,11-dimethyl-5-propan-2-yl-15-oxatetracyclo[9.3.2.01,10.02,7]hexadecan-16-one |
| SMILES | CC(C)[C@@H]1CC[C@]2(C)[C@@H](CC[C@@H]3[C@@]4(C)CCC[C@]32OC4=O)C1 |
| InChI | InChI=1S/C20H32O2/c1-13(2)14-8-11-19(4)15(12-14)6-7-16-18(3)9-5-10-20(16,19)22-17(18)21/h13-16H,5-12H2,1-4H3/t14-,15+,16-,18-,19-,20+/m1/s1 |
| InChIKey | JMDLYACWFYZOQW-UXESJPJBSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |