C14H13F2N3O5S — CID 165367173
(4aR,8aS)-8a-(2,2-difluoro-6-nitro-1,3-benzodioxol-4-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 165367173) has the molecular formula C14H13F2N3O5S and a molecular weight of 373.34 g/mol. Its IUPAC name is (4aR,8aS)-8a-(2,2-difluoro-6-nitro-1,3-benzodioxol-4-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,8aS)-8a-(2,2-difluoro-6-nitro-1,3-benzodioxol-4-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 165367173 |
| Molecular Formula | C14H13F2N3O5S |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | (4aR,8aS)-8a-(2,2-difluoro-6-nitro-1,3-benzodioxol-4-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cc([N+](=O)[O-])cc4c3OC(F)(F)O4)COCC[C@H]2CS1 |
| InChI | InChI=1S/C14H13F2N3O5S/c15-14(16)23-10-4-8(19(20)21)3-9(11(10)24-14)13-6-22-2-1-7(13)5-25-12(17)18-13/h3-4,7H,1-2,5-6H2,(H2,17,18)/t7-,13-/m0/s1 |
| InChIKey | KMZSEPQWRKXUKI-CPFSXVBKSA-N |
| XLogP | 2.21 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|