C30H52O12 — CID 165367539
(1S,3R,4S,5S,6R,8R,10S,17Z,29R,30S,31S,32R)-4,5,30,31,32-pentahydroxy-6-(hydroxymethyl)-10-methyl-2,7,9,27,33-pentaoxatricyclo[27.3.1.03,8]tritriacont-17-en-26-one (PubChem CID 165367539) has the molecular formula C30H52O12 and a molecular weight of 604.73 g/mol. Its IUPAC name is (1S,3R,4S,5S,6R,8R,10S,17Z,29R,30S,31S,32R)-4,5,30,31,32-pentahydroxy-6-(hydroxymethyl)-10-methyl-2,7,9,27,33-pentaoxatricyclo[27.3.1.03,8]tritriacont-17-en-26-one.
| Compound Name | (1S,3R,4S,5S,6R,8R,10S,17Z,29R,30S,31S,32R)-4,5,30,31,32-pentahydroxy-6-(hydroxymethyl)-10-methyl-2,7,9,27,33-pentaoxatricyclo[27.3.1.03,8]tritriacont-17-en-26-one |
|---|---|
| PubChem CID | 165367539 |
| Molecular Formula | C30H52O12 |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | (1S,3R,4S,5S,6R,8R,10S,17Z,29R,30S,31S,32R)-4,5,30,31,32-pentahydroxy-6-(hydroxymethyl)-10-methyl-2,7,9,27,33-pentaoxatricyclo[27.3.1.03,8]tritriacont-17-en-26-one |
| SMILES | C[C@H]1CCCCCC/C=C\CCCCCCCC(=O)OC[C@H]2O[C@@H](O[C@H]3[C@H](O1)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C30H52O12/c1-19-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-22(32)38-18-21-24(34)25(35)27(37)29(41-21)42-28-26(36)23(33)20(17-31)40-30(28)39-19/h2-3,19-21,23-31,33-37H,4-18H2,1H3/b3-2-/t19-,20+,21+,23+,24+,25-,26-,27+,28+,29-,30+/m0/s1 |
| InChIKey | ZZBKXERYMMXQNJ-VGJBVMJTSA-N |
| XLogP | 1.21 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|