About [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride
[2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride (PubChem CID 165368053) has the molecular formula C9H19ClF3NOS
and a molecular weight of 281.77 g/mol. Its IUPAC name is [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride.
Molecular Properties
| Compound Name | [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride |
| PubChem CID | 165368053 |
| Molecular Formula | C9H19ClF3NOS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CC(O)CSCCC(F)(F)F.[Cl-] |
| InChI | InChI=1S/C9H19F3NOS.ClH/c1-13(2,3)6-8(14)7-15-5-4-9(10,11)12;/h8,14H,4-7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CRTRUQAIULMFAH-UHFFFAOYSA-M |
| XLogP | -1.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride?
The IUPAC name of [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride (CID 165368053) is [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride.
What is the SMILES notation for [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride?
The canonical SMILES for [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride is C[N+](C)(C)CC(O)CSCCC(F)(F)F.[Cl-].
What is the InChIKey of [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride?
The InChIKey is CRTRUQAIULMFAH-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H19F3NOS.ClH/c1-13(2,3)6-8(14)7-15-5-4-9(10,11)12;/h8,14H,4-7H2,1-3H3;1H/q+1;/p-1.
What are the key properties of [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride?
[2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride has a molecular weight of 281.77 g/mol, XLogP of -1.26, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxy-3-(3,3,3-trifluoropropylsulfanyl)propyl]-trimethylazanium chloride is sourced from PubChem (CID 165368053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).