C22H26FNO5 — CID 165368410
(3E,6R)-3-[5-[4-(4-fluorophenyl)piperidin-1-yl]-1-hydroxy-5-oxopentylidene]-6-methyloxane-2,4-dione (PubChem CID 165368410) has the molecular formula C22H26FNO5 and a molecular weight of 403.45 g/mol. Its IUPAC name is (3E,6R)-3-[5-[4-(4-fluorophenyl)piperidin-1-yl]-1-hydroxy-5-oxopentylidene]-6-methyloxane-2,4-dione.
| Compound Name | (3E,6R)-3-[5-[4-(4-fluorophenyl)piperidin-1-yl]-1-hydroxy-5-oxopentylidene]-6-methyloxane-2,4-dione |
|---|---|
| PubChem CID | 165368410 |
| Molecular Formula | C22H26FNO5 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (3E,6R)-3-[5-[4-(4-fluorophenyl)piperidin-1-yl]-1-hydroxy-5-oxopentylidene]-6-methyloxane-2,4-dione |
| SMILES | C[C@@H]1CC(=O)/C(=C(\O)CCCC(=O)N2CCC(c3ccc(F)cc3)CC2)C(=O)O1 |
| InChI | InChI=1S/C22H26FNO5/c1-14-13-19(26)21(22(28)29-14)18(25)3-2-4-20(27)24-11-9-16(10-12-24)15-5-7-17(23)8-6-15/h5-8,14,16,25H,2-4,9-13H2,1H3/b21-18+/t14-/m1/s1 |
| InChIKey | LKKORZKZPSVZMV-DCKJRJMFSA-N |
| XLogP | 3.42 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|