C30H48 — CID 165368626
(1R,2E,6E,10E,14E,18E,22R)-3,7,11,15,19,23,23-heptamethylbicyclo[20.1.0]tricosa-2,6,10,14,18-pentaene (PubChem CID 165368626) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is (1R,2E,6E,10E,14E,18E,22R)-3,7,11,15,19,23,23-heptamethylbicyclo[20.1.0]tricosa-2,6,10,14,18-pentaene.
| Compound Name | (1R,2E,6E,10E,14E,18E,22R)-3,7,11,15,19,23,23-heptamethylbicyclo[20.1.0]tricosa-2,6,10,14,18-pentaene |
|---|---|
| PubChem CID | 165368626 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | (1R,2E,6E,10E,14E,18E,22R)-3,7,11,15,19,23,23-heptamethylbicyclo[20.1.0]tricosa-2,6,10,14,18-pentaene |
| SMILES | C/C1=C\CC/C(C)=C/CC/C(C)=C/[C@@H]2[C@@H](CC/C(C)=C/CC/C(C)=C/CC1)C2(C)C |
| InChI | InChI=1S/C30H48/c1-23-12-8-14-24(2)16-10-18-26(4)20-21-28-29(30(28,6)7)22-27(5)19-11-17-25(3)15-9-13-23/h13-14,17-18,22,28-29H,8-12,15-16,19-21H2,1-7H3/b23-13+,24-14+,25-17+,26-18+,27-22+/t28-,29-/m1/s1 |
| InChIKey | RHBWEVCRGQZVST-SGDJXXCCSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|