C30H48 — CID 165368628
(5E,9E)-1-[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]-3a,6,10-trimethyl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene (PubChem CID 165368628) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is (5E,9E)-1-[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]-3a,6,10-trimethyl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene.
| Compound Name | (5E,9E)-1-[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]-3a,6,10-trimethyl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene |
|---|---|
| PubChem CID | 165368628 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | (5E,9E)-1-[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]-3a,6,10-trimethyl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)C1=CCC2(C)C/C=C(\C)CC/C=C(\C)CCC12 |
| InChI | InChI=1S/C30H48/c1-23(2)11-8-12-24(3)15-10-16-27(6)28-20-22-30(7)21-19-26(5)14-9-13-25(4)17-18-29(28)30/h11,13,15,19-20,27,29H,8-10,12,14,16-18,21-22H2,1-7H3/b24-15+,25-13+,26-19+ |
| InChIKey | VVHPNQSUMLARNW-IKWXLNSOSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|