About 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol
3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol (PubChem CID 165368796) has the molecular formula C10H8F5NO3S
and a molecular weight of 317.24 g/mol. Its IUPAC name is 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol |
| PubChem CID | 165368796 |
| Molecular Formula | C10H8F5NO3S |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol |
| SMILES | O=S(=O)(c1cc(O)cc(C(F)(F)F)c1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C10H8F5NO3S/c11-9(12)4-16(5-9)20(18,19)8-2-6(10(13,14)15)1-7(17)3-8/h1-3,17H,4-5H2 |
| InChIKey | NOULYZJMSYDEBD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol?
The IUPAC name of 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol (CID 165368796) is 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol.
What is the SMILES notation for 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol?
The canonical SMILES for 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol is O=S(=O)(c1cc(O)cc(C(F)(F)F)c1)N1CC(F)(F)C1.
What is the InChIKey of 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol?
The InChIKey is NOULYZJMSYDEBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F5NO3S/c11-9(12)4-16(5-9)20(18,19)8-2-6(10(13,14)15)1-7(17)3-8/h1-3,17H,4-5H2.
What are the key properties of 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol?
3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol has a molecular weight of 317.24 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluoroazetidin-1-yl)sulfonyl-5-(trifluoromethyl)phenol is sourced from PubChem (CID 165368796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).