C5H5N7O7 — CID 165369518
N-[3-(1,1-dinitro-2-oxopropyl)-1H-1,2,4-triazol-5-yl]nitramide (PubChem CID 165369518) has the molecular formula C5H5N7O7 and a molecular weight of 275.14 g/mol. Its IUPAC name is N-[3-(1,1-dinitro-2-oxopropyl)-1H-1,2,4-triazol-5-yl]nitramide.
| Compound Name | N-[3-(1,1-dinitro-2-oxopropyl)-1H-1,2,4-triazol-5-yl]nitramide |
|---|---|
| PubChem CID | 165369518 |
| Molecular Formula | C5H5N7O7 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | N-[3-(1,1-dinitro-2-oxopropyl)-1H-1,2,4-triazol-5-yl]nitramide |
| SMILES | CC(=O)C(c1n[nH]c(N[N+](=O)[O-])n1)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H5N7O7/c1-2(13)5(10(14)15,11(16)17)3-6-4(8-7-3)9-12(18)19/h1H3,(H2,6,7,8,9) |
| InChIKey | GCNSTITWLJZPTJ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 200.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|