C20H25N5O4S — CID 165369648
1-[amino-[(2S)-2-(hydroxymethyl)-2-methyl-3H-pyrazolo[5,1-b][1,3]oxazol-7-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 165369648) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-[amino-[(2S)-2-(hydroxymethyl)-2-methyl-3H-pyrazolo[5,1-b][1,3]oxazol-7-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-[(2S)-2-(hydroxymethyl)-2-methyl-3H-pyrazolo[5,1-b][1,3]oxazol-7-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 165369648 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[amino-[(2S)-2-(hydroxymethyl)-2-methyl-3H-pyrazolo[5,1-b][1,3]oxazol-7-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | C[C@@]1(CO)Cn2ncc(S(N)(=O)=NC(=O)Nc3c4c(cc5c3CCC5)CCC4)c2O1 |
| InChI | InChI=1S/C20H25N5O4S/c1-20(11-26)10-25-18(29-20)16(9-22-25)30(21,28)24-19(27)23-17-14-6-2-4-12(14)8-13-5-3-7-15(13)17/h8-9,26H,2-7,10-11H2,1H3,(H3,21,23,24,27,28)/t20-,30?/m0/s1 |
| InChIKey | QWNNBZIREQRSJA-JGZNSJETSA-N |
| XLogP | 1.94 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |