C40H35F2N5O6 — CID 165371359
5-[3-[5-[5-(difluoromethyl)pyrido[3,2-b]indol-7-yl]spiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl]propoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 165371359) has the molecular formula C40H35F2N5O6 and a molecular weight of 719.75 g/mol. Its IUPAC name is 5-[3-[5-[5-(difluoromethyl)pyrido[3,2-b]indol-7-yl]spiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl]propoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[5-[5-(difluoromethyl)pyrido[3,2-b]indol-7-yl]spiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl]propoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 165371359 |
| Molecular Formula | C40H35F2N5O6 |
| Molecular Weight | 719.75 g/mol |
| Exact Mass | 719.26 |
| IUPAC Name | 5-[3-[5-[5-(difluoromethyl)pyrido[3,2-b]indol-7-yl]spiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl]propoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCCN4CCC5(CC4)Cc4cc(-c6ccc7c8ncccc8n(C(F)F)c7c6)ccc4O5)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H35F2N5O6/c41-39(42)46-30-3-1-14-43-35(30)28-7-4-24(20-32(28)46)23-5-10-33-25(19-23)22-40(53-33)12-16-45(17-13-40)15-2-18-52-26-6-8-27-29(21-26)38(51)47(37(27)50)31-9-11-34(48)44-36(31)49/h1,3-8,10,14,19-21,31,39H,2,9,11-13,15-18,22H2,(H,44,48,49) |
| InChIKey | MTUBEMLDXHBVGF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.75 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|