About 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine
2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine (PubChem CID 165371576) has the molecular formula C15H14BrN3
and a molecular weight of 316.20 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine |
| PubChem CID | 165371576 |
| Molecular Formula | C15H14BrN3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine |
| SMILES | CN(C)c1ccn2cc(-c3ccc(Br)cc3)nc2c1 |
| InChI | InChI=1S/C15H14BrN3/c1-18(2)13-7-8-19-10-14(17-15(19)9-13)11-3-5-12(16)6-4-11/h3-10H,1-2H3 |
| InChIKey | BPAHPZSQZJCLNQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine?
The IUPAC name of 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine (CID 165371576) is 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine.
What is the SMILES notation for 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine?
The canonical SMILES for 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine is CN(C)c1ccn2cc(-c3ccc(Br)cc3)nc2c1.
What is the InChIKey of 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine?
The InChIKey is BPAHPZSQZJCLNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrN3/c1-18(2)13-7-8-19-10-14(17-15(19)9-13)11-3-5-12(16)6-4-11/h3-10H,1-2H3.
What are the key properties of 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine?
2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine has a molecular weight of 316.20 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-N,N-dimethylimidazo[1,2-a]pyridin-7-amine is sourced from PubChem (CID 165371576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).