C21H33BrO3 — CID 165371697
2-bromo-1-[(1R,2S,5R,7R,10R,11S,13S,14S)-5-hydroxy-5-(methoxymethyl)-14-methyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]ethanone (PubChem CID 165371697) has the molecular formula C21H33BrO3 and a molecular weight of 413.40 g/mol. Its IUPAC name is 2-bromo-1-[(1R,2S,5R,7R,10R,11S,13S,14S)-5-hydroxy-5-(methoxymethyl)-14-methyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]ethanone.
| Compound Name | 2-bromo-1-[(1R,2S,5R,7R,10R,11S,13S,14S)-5-hydroxy-5-(methoxymethyl)-14-methyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]ethanone |
|---|---|
| PubChem CID | 165371697 |
| Molecular Formula | C21H33BrO3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-bromo-1-[(1R,2S,5R,7R,10R,11S,13S,14S)-5-hydroxy-5-(methoxymethyl)-14-methyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]ethanone |
| SMILES | COC[C@@]1(O)CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](C(=O)CBr)C[C@@H]32)C1 |
| InChI | InChI=1S/C21H33BrO3/c1-20-7-5-15-14-6-8-21(24,12-25-2)10-13(14)3-4-16(15)17(20)9-18(20)19(23)11-22/h13-18,24H,3-12H2,1-2H3/t13-,14+,15-,16-,17+,18-,20+,21-/m1/s1 |
| InChIKey | GNHADBGWOFSIMF-AASDQNTMSA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|