About sodium;3-methanidylideneoxan-2-one;hydroxide
sodium;3-methanidylideneoxan-2-one;hydroxide (PubChem CID 165372551) has the molecular formula C6H8NaO3-
and a molecular weight of 151.12 g/mol. Its IUPAC name is sodium;3-methanidylideneoxan-2-one;hydroxide.
Molecular Properties
| Compound Name | sodium;3-methanidylideneoxan-2-one;hydroxide |
| PubChem CID | 165372551 |
| Molecular Formula | C6H8NaO3- |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | sodium;3-methanidylideneoxan-2-one;hydroxide |
| SMILES | [H]/[C-]=C1/CCCOC1=O.[Na+].[OH-] |
| InChI | InChI=1S/C6H7O2.Na.H2O/c1-5-3-2-4-8-6(5)7;;/h1H,2-4H2;;1H2/q-1;+1;/p-1 |
| InChIKey | QPXPGUYMFOEUFZ-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-methanidylideneoxan-2-one;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-methanidylideneoxan-2-one;hydroxide?
The IUPAC name of sodium;3-methanidylideneoxan-2-one;hydroxide (CID 165372551) is sodium;3-methanidylideneoxan-2-one;hydroxide.
What is the SMILES notation for sodium;3-methanidylideneoxan-2-one;hydroxide?
The canonical SMILES for sodium;3-methanidylideneoxan-2-one;hydroxide is [H]/[C-]=C1/CCCOC1=O.[Na+].[OH-].
What is the InChIKey of sodium;3-methanidylideneoxan-2-one;hydroxide?
The InChIKey is QPXPGUYMFOEUFZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7O2.Na.H2O/c1-5-3-2-4-8-6(5)7;;/h1H,2-4H2;;1H2/q-1;+1;/p-1.
What are the key properties of sodium;3-methanidylideneoxan-2-one;hydroxide?
sodium;3-methanidylideneoxan-2-one;hydroxide has a molecular weight of 151.12 g/mol, XLogP of -2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-methanidylideneoxan-2-one;hydroxide is sourced from PubChem (CID 165372551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).