C14H22N2 — CID 165372704
2,3-di(propan-2-yl)-3,4-dihydro-1H-2,6-naphthyridine (PubChem CID 165372704) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-3,4-dihydro-1H-2,6-naphthyridine.
| Compound Name | 2,3-di(propan-2-yl)-3,4-dihydro-1H-2,6-naphthyridine |
|---|---|
| PubChem CID | 165372704 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2,3-di(propan-2-yl)-3,4-dihydro-1H-2,6-naphthyridine |
| SMILES | CC(C)C1Cc2cnccc2CN1C(C)C |
| InChI | InChI=1S/C14H22N2/c1-10(2)14-7-13-8-15-6-5-12(13)9-16(14)11(3)4/h5-6,8,10-11,14H,7,9H2,1-4H3 |
| InChIKey | KMWNZPQWXCLKLK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |