C31H34N6O5 — CID 165374028
tert-butyl 2-[5-(3'-methyl-2'-oxospiro[cyclobutane-1,1'-pyrrolo[2,3-c]quinoline]-8'-yl)-3-nitro-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 165374028) has the molecular formula C31H34N6O5 and a molecular weight of 570.65 g/mol. Its IUPAC name is tert-butyl 2-[5-(3'-methyl-2'-oxospiro[cyclobutane-1,1'-pyrrolo[2,3-c]quinoline]-8'-yl)-3-nitro-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[5-(3'-methyl-2'-oxospiro[cyclobutane-1,1'-pyrrolo[2,3-c]quinoline]-8'-yl)-3-nitro-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 165374028 |
| Molecular Formula | C31H34N6O5 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | tert-butyl 2-[5-(3'-methyl-2'-oxospiro[cyclobutane-1,1'-pyrrolo[2,3-c]quinoline]-8'-yl)-3-nitro-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CN1C(=O)C2(CCC2)c2c1cnc1ccc(-c3cnc(N4CC5CN(C(=O)OC(C)(C)C)CC5C4)c([N+](=O)[O-])c3)cc21 |
| InChI | InChI=1S/C31H34N6O5/c1-30(2,3)42-29(39)36-16-20-14-35(15-21(20)17-36)27-24(37(40)41)11-19(12-33-27)18-6-7-23-22(10-18)26-25(13-32-23)34(4)28(38)31(26)8-5-9-31/h6-7,10-13,20-21H,5,8-9,14-17H2,1-4H3 |
| InChIKey | MXNMTDKXKSWROX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 122.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|