C10H14N3+ — CID 165374320
7-tert-butyl-8aH-[1,2,4]triazolo[4,3-a]pyridin-4-ium (PubChem CID 165374320) has the molecular formula C10H14N3+ and a molecular weight of 176.24 g/mol. Its IUPAC name is 7-tert-butyl-8aH-[1,2,4]triazolo[4,3-a]pyridin-4-ium.
| Compound Name | 7-tert-butyl-8aH-[1,2,4]triazolo[4,3-a]pyridin-4-ium |
|---|---|
| PubChem CID | 165374320 |
| Molecular Formula | C10H14N3+ |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 7-tert-butyl-8aH-[1,2,4]triazolo[4,3-a]pyridin-4-ium |
| SMILES | CC(C)(C)C1=CC2N=NC=[N+]2C=C1 |
| InChI | InChI=1S/C10H14N3/c1-10(2,3)8-4-5-13-7-11-12-9(13)6-8/h4-7,9H,1-3H3/q+1 |
| InChIKey | XRJDHBJSSXQGAY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 27.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|