About CID 165374920
CID 165374920 (PubChem CID 165374920) has the molecular formula C66H61F3N4O
and a molecular weight of 983.23 g/mol.
Molecular Properties
| Compound Name | CID 165374920 |
| PubChem CID | 165374920 |
| Molecular Formula | C66H61F3N4O |
| Molecular Weight | 983.23 g/mol |
| Exact Mass | 982.48 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)C1(c3ccc(Oc4ccc5c6ccccc6n(-c6ccccn6)c5c4)cc3-n3[c-][n+](-c4ccc(C(F)(F)F)cc4)c4cccc1c43)c1c-2cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C66H61F3N4O/c1-61(2,3)40-32-47-48-33-41(62(4,5)6)35-52(64(10,11)12)59(48)65(58(47)51(34-40)63(7,8)9)49-30-28-44(74-43-27-29-46-45-18-13-14-20-53(45)73(55(46)36-43)57-22-15-16-31-70-57)37-56(49)72-38-71(54-21-17-19-50(65)60(54)72)42-25-23-39(24-26-42)66(67,68)69/h13-37H,1-12H3 |
| InChIKey | VWPWHDUJVBHEEH-UHFFFAOYSA-N |
| XLogP | 16.88 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 74 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 983.23 |
| LogP ≤ 5 | 16.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 165374920 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165374920?
The IUPAC name of CID 165374920 (CID 165374920) is not available.
What is the SMILES notation for CID 165374920?
The canonical SMILES for CID 165374920 is CC(C)(C)c1cc2c(c(C(C)(C)C)c1)C1(c3ccc(Oc4ccc5c6ccccc6n(-c6ccccn6)c5c4)cc3-n3[c-][n+](-c4ccc(C(F)(F)F)cc4)c4cccc1c43)c1c-2cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of CID 165374920?
The InChIKey is VWPWHDUJVBHEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C66H61F3N4O/c1-61(2,3)40-32-47-48-33-41(62(4,5)6)35-52(64(10,11)12)59(48)65(58(47)51(34-40)63(7,8)9)49-30-28-44(74-43-27-29-46-45-18-13-14-20-53(45)73(55(46)36-43)57-22-15-16-31-70-57)37-56(49)72-38-71(54-21-17-19-50(65)60(54)72)42-25-23-39(24-26-42)66(67,68)69/h13-37H,1-12H3.
What are the key properties of CID 165374920?
CID 165374920 has a molecular weight of 983.23 g/mol, XLogP of 16.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165374920 is sourced from PubChem (CID 165374920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).