C68H68N5OPt-3 — CID 165374942
CID 165374942 (PubChem CID 165374942) has the molecular formula C68H68N5OPt-3 and a molecular weight of 1166.40 g/mol.
| Compound Name | CID 165374942 |
|---|---|
| PubChem CID | 165374942 |
| Molecular Formula | C68H68N5OPt-3 |
| Molecular Weight | 1166.40 g/mol |
| Exact Mass | 1165.51 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2cnc(-n3c4[c-]c(Oc5[c-]c6c(cc5)C5(c7cccc8c7N6[CH-]N8C)c6c(cc(C(C)(C)C)cc6C(C)(C)C)-c6cc(C(C)(C)C)cc(C(C)(C)C)c65)ccc4c4ccccc43)cc2C)cc(C)n1.[Pt] |
| InChI | InChI=1S/C68H68N5O.Pt/c1-39-28-60(69-37-51(39)42-29-40(2)70-41(3)30-42)73-56-22-18-17-20-47(56)48-26-24-45(35-58(48)73)74-46-25-27-52-59(36-46)72-38-71(16)57-23-19-21-53(63(57)72)68(52)61-49(31-43(64(4,5)6)33-54(61)66(10,11)12)50-32-44(65(7,8)9)34-55(62(50)68)67(13,14)15;/h17-34,37-38H,1-16H3;/q-3; |
| InChIKey | HFDUSTTUGHDZEF-UHFFFAOYSA-N |
| XLogP | 17.13 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1166.40 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|