About CID 165374959
CID 165374959 (PubChem CID 165374959) has the molecular formula C66H60F3N4OPt-3
and a molecular weight of 1177.30 g/mol.
Molecular Properties
| Compound Name | CID 165374959 |
| PubChem CID | 165374959 |
| Molecular Formula | C66H60F3N4OPt-3 |
| Molecular Weight | 1177.30 g/mol |
| Exact Mass | 1176.44 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)C1(c3ccc(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)[c-]c3N3[CH-]N(c4ccc(C(F)(F)F)cc4)c4cccc1c43)c1c-2cc(C(C)(C)C)cc1C(C)(C)C.[Pt] |
| InChI | InChI=1S/C66H60F3N4O.Pt/c1-61(2,3)40-32-47-48-33-41(62(4,5)6)35-52(64(10,11)12)59(48)65(58(47)51(34-40)63(7,8)9)49-30-28-44(74-43-27-29-46-45-18-13-14-20-53(45)73(55(46)36-43)57-22-15-16-31-70-57)37-56(49)72-38-71(54-21-17-19-50(65)60(54)72)42-25-23-39(24-26-42)66(67,68)69;/h13-35,38H,1-12H3;/q-3; |
| InChIKey | PSGVNYVBBBGKOR-UHFFFAOYSA-N |
| XLogP | 17.86 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 75 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1177.30 |
| LogP ≤ 5 | 17.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 165374959 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165374959?
The IUPAC name of CID 165374959 (CID 165374959) is not available.
What is the SMILES notation for CID 165374959?
The canonical SMILES for CID 165374959 is CC(C)(C)c1cc2c(c(C(C)(C)C)c1)C1(c3ccc(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)[c-]c3N3[CH-]N(c4ccc(C(F)(F)F)cc4)c4cccc1c43)c1c-2cc(C(C)(C)C)cc1C(C)(C)C.[Pt].
What is the InChIKey of CID 165374959?
The InChIKey is PSGVNYVBBBGKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C66H60F3N4O.Pt/c1-61(2,3)40-32-47-48-33-41(62(4,5)6)35-52(64(10,11)12)59(48)65(58(47)51(34-40)63(7,8)9)49-30-28-44(74-43-27-29-46-45-18-13-14-20-53(45)73(55(46)36-43)57-22-15-16-31-70-57)37-56(49)72-38-71(54-21-17-19-50(65)60(54)72)42-25-23-39(24-26-42)66(67,68)69;/h13-35,38H,1-12H3;/q-3;.
What are the key properties of CID 165374959?
CID 165374959 has a molecular weight of 1177.30 g/mol, XLogP of 17.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165374959 is sourced from PubChem (CID 165374959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).