C25H25NO — CID 165375490
2-(1-methylindol-3-yl)-1,1-bis(4-methylphenyl)ethanol (PubChem CID 165375490) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-(1-methylindol-3-yl)-1,1-bis(4-methylphenyl)ethanol.
| Compound Name | 2-(1-methylindol-3-yl)-1,1-bis(4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 165375490 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-(1-methylindol-3-yl)-1,1-bis(4-methylphenyl)ethanol |
| SMILES | Cc1ccc(C(O)(Cc2cn(C)c3ccccc23)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H25NO/c1-18-8-12-21(13-9-18)25(27,22-14-10-19(2)11-15-22)16-20-17-26(3)24-7-5-4-6-23(20)24/h4-15,17,27H,16H2,1-3H3 |
| InChIKey | HMPJHWHFKVTHPY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |