C48H38N2O — CID 165377184
3-[3-(1,8-dimethylcarbazol-9-yl)phenyl]-10,10-dimethyl-6-(N-phenylanilino)anthracen-9-one (PubChem CID 165377184) has the molecular formula C48H38N2O and a molecular weight of 658.85 g/mol. Its IUPAC name is 3-[3-(1,8-dimethylcarbazol-9-yl)phenyl]-10,10-dimethyl-6-(N-phenylanilino)anthracen-9-one.
| Compound Name | 3-[3-(1,8-dimethylcarbazol-9-yl)phenyl]-10,10-dimethyl-6-(N-phenylanilino)anthracen-9-one |
|---|---|
| PubChem CID | 165377184 |
| Molecular Formula | C48H38N2O |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | 3-[3-(1,8-dimethylcarbazol-9-yl)phenyl]-10,10-dimethyl-6-(N-phenylanilino)anthracen-9-one |
| SMILES | Cc1cccc2c3cccc(C)c3n(-c3cccc(-c4ccc5c(c4)C(C)(C)c4cc(N(c6ccccc6)c6ccccc6)ccc4C5=O)c3)c12 |
| InChI | InChI=1S/C48H38N2O/c1-31-14-11-22-39-40-23-12-15-32(2)46(40)50(45(31)39)37-21-13-16-33(28-37)34-24-26-41-43(29-34)48(3,4)44-30-38(25-27-42(44)47(41)51)49(35-17-7-5-8-18-35)36-19-9-6-10-20-36/h5-30H,1-4H3 |
| InChIKey | MDKQVIYRSKSHHH-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |