C19H15F3N2O4S2 — CID 165377626
(2-methylsulfanyl-7-naphthalen-1-yl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl) trifluoromethanesulfonate (PubChem CID 165377626) has the molecular formula C19H15F3N2O4S2 and a molecular weight of 456.47 g/mol. Its IUPAC name is (2-methylsulfanyl-7-naphthalen-1-yl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl) trifluoromethanesulfonate.
| Compound Name | (2-methylsulfanyl-7-naphthalen-1-yl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 165377626 |
| Molecular Formula | C19H15F3N2O4S2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | (2-methylsulfanyl-7-naphthalen-1-yl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl) trifluoromethanesulfonate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)COC(c1cccc3ccccc13)C2 |
| InChI | InChI=1S/C19H15F3N2O4S2/c1-29-18-23-15-9-16(13-8-4-6-11-5-2-3-7-12(11)13)27-10-14(15)17(24-18)28-30(25,26)19(20,21)22/h2-8,16H,9-10H2,1H3 |
| InChIKey | UNNUINOSDGTJHR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|